CAS 857001-14-0 appears in our catalog under these names: 2–Bromo–4,5–dinitrotoluene, 1-Bromo-2-methyl-4,5-dinitrobenzene, >95%, >95%, 2-BROMO-4,5-DINITROTOLUENE, >95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
1-bromo-2-methyl-4,5-dinitrobenzene (CAS 857001-14-0) is a chemical compound with the molecular formula C7H5BrN2O4 and a molecular weight of 261.03 g/mol. IUPAC name: 1-bromo-2-methyl-4,5-dinitrobenzene. InChIKey: DSQHAQRGHKMWNC-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O4 |
|---|---|
| Molecular weight | 261.03 g/mol |
| IUPAC name | 1-bromo-2-methyl-4,5-dinitrobenzene |
| InChIKey | DSQHAQRGHKMWNC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)