cas: 16175-67-0 — see every product listed under this CAS number, including other names
2-Amino-6,7-dimethoxyquinazolin-4(3H)-one (CAS 16175-67-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112VUU-250mg |
| cas | 16175-67-0 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 587.60 Pln |
| delivery time | 3 weeks |
|---|
2-amino-6,7-dimethoxy-3H-quinazolin-4-one (CAS 16175-67-0) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: 2-amino-6,7-dimethoxy-3H-quinazolin-4-one. InChIKey: OEASVAKVZYHCQH-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 2-amino-6,7-dimethoxy-3H-quinazolin-4-one |
| InChIKey | OEASVAKVZYHCQH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)NC(=N2)N)OC |
Computed by PubChem (NCBI)