CAS 194788-54-0 appears in our catalog under these names: N-Allyl-n'-(4-nitrophenyl)urea, 95%, 1-(4-Nitrophenyl)-3-(prop-2-en-1-yl)urea, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(4-nitrophenyl)-3-prop-2-enylurea (CAS 194788-54-0) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: 1-(4-nitrophenyl)-3-prop-2-enylurea. InChIKey: GRHHTPVRSZOONH-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-3-prop-2-enylurea |
| InChIKey | GRHHTPVRSZOONH-UHFFFAOYSA-N |
| SMILES | C=CCNC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)