CAS 16175-67-0 appears in our catalog under these names: 2-Amino-6,7-dimethoxyquinazolin-4(3h)-one, 95%, 2-Amino-6,7-dimethoxyquinazolin-4(3H)-one. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg.
2-amino-6,7-dimethoxy-3H-quinazolin-4-one (CAS 16175-67-0) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: 2-amino-6,7-dimethoxy-3H-quinazolin-4-one. InChIKey: OEASVAKVZYHCQH-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 2-amino-6,7-dimethoxy-3H-quinazolin-4-one |
| InChIKey | OEASVAKVZYHCQH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)NC(=N2)N)OC |
Computed by PubChem (NCBI)