CAS 64393-00-6 appears in our catalog under these names: 3-Cyclopropyl-1-(3-nitrophenyl)urea, 95%, 3-Cyclopropyl-1-(3-nitrophenyl)urea. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
1-cyclopropyl-3-(3-nitrophenyl)urea (CAS 64393-00-6) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: 1-cyclopropyl-3-(3-nitrophenyl)urea. InChIKey: UHEYQOOFVUXABF-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 1-cyclopropyl-3-(3-nitrophenyl)urea |
| InChIKey | UHEYQOOFVUXABF-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)NC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)