CAS 60135-71-9 appears in our catalog under these names: 5-(3,4-Dimethoxyphenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(3,4-Dimethoxyphenyl)-1,3,4-oxadiazol-2-amine, 5-(3,4-Dimethoxyphenyl)-1,3,4-oxadiazol-2-amine 97%, 5-(3,4-Dimethoxyphenyl)-1,3,4-oxadiazol-2-amine, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 100mg.
5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-amine (CAS 60135-71-9) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-amine. InChIKey: OZWPUJJRZSGNEE-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | OZWPUJJRZSGNEE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NN=C(O2)N)OC |
Computed by PubChem (NCBI)