CAS 956628-37-8 appears in our catalog under these names: 5-Methyl-4-[(4-methyl-1h-pyrazol-1-yl)methyl]isoxazole-3-carboxylic acid, 95%, 5-Methyl-4-((4-methyl-1H-pyrazol-1-yl)methyl)isoxazole-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
5-methyl-4-[(4-methylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid (CAS 956628-37-8) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: 5-methyl-4-[(4-methylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid. InChIKey: HOPCBVGVMTZTOG-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 5-methyl-4-[(4-methylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid |
| InChIKey | HOPCBVGVMTZTOG-UHFFFAOYSA-N |
| SMILES | CC1=CN(N=C1)CC2=C(ON=C2C(=O)O)C |
Computed by PubChem (NCBI)