CAS 957487-33-1 appears in our catalog under these names: 3-(1-Ethyl-5-methyl-1h-pyrazol-4-yl)isoxazole-5-carboxylic acid, 95%, 3-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)isoxazole-5-carboxylic acid, 95+%, 3-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)isoxazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 10g, 5g.
3-(1-ethyl-5-methylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid (CAS 957487-33-1) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: 3-(1-ethyl-5-methylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid. InChIKey: FKGSVAZABZXXDJ-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 3-(1-ethyl-5-methylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | FKGSVAZABZXXDJ-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C=N1)C2=NOC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)