Products 1439900-54-5
CAS 1439900-54-5 appears in our catalog under these names: 6-[2-Oxo-tetrahydropyrimidin-1(2h)-yl]nicotinic acid, 95%, 6-(2-Oxotetrahydropyrimidin-1(2H)-yl)nicotinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
6-(2-oxo-1,3-diazinan-1-yl)pyridine-3-carboxylic acid (CAS 1439900-54-5) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: 6-(2-oxo-1,3-diazinan-1-yl)pyridine-3-carboxylic acid. InChIKey: ZNFISAYEINTSOY-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 6-(2-oxo-1,3-diazinan-1-yl)pyridine-3-carboxylic acid |
| InChIKey | ZNFISAYEINTSOY-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)N(C1)C2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)