cas: 1394003-86-1 — see every product listed under this CAS number, including other names
2-Aminopyrazolo[1,5-a]pyrimidine-3-carboxylic acid 95% (CAS 1394003-86-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A277450-25g |
| cas | 1394003-86-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 4136.19 Pln | |
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1227.00 Pln | |
| Ambeed | 10g | 2100.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A277450 |
2-aminopyrazolo[1,5-a]pyrimidine-3-carboxylic acid (CAS 1394003-86-1) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxylic acid. InChIKey: RGVPAUFBNKASEL-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| InChIKey | RGVPAUFBNKASEL-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C(=N2)N)C(=O)O)N=C1 |
Computed by PubChem (NCBI)