cas: 102293-80-1 — see every product listed under this CAS number, including other names
2-BROMO-1-(2,2-DIMETHYL-4H-1,3-BENZODIOXIN-6-YL)ETHANONE, 97% (CAS 102293-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F500364-100MG |
| cas | 102293-80-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 508.17 Pln | |
| Fluorochem | 5g | 1596.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanone (CAS 102293-80-1) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: 2-bromo-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanone. InChIKey: SJYXUPGLQCUYJS-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | 2-bromo-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanone |
| InChIKey | SJYXUPGLQCUYJS-UHFFFAOYSA-N |
| SMILES | CC1(OCC2=C(O1)C=CC(=C2)C(=O)CBr)C |
Computed by PubChem (NCBI)