cas: 102293-80-1 — see every product listed under this CAS number, including other names
2-Bromo-1-(2,2-dimethyl-4H-benzo[d][1,3]dioxin-6-yl)ethanone, 97%, 97% (CAS 102293-80-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111860-10g |
| cas | 102293-80-1 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1336.40 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 760.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanone (CAS 102293-80-1) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: 2-bromo-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanone. InChIKey: SJYXUPGLQCUYJS-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | 2-bromo-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanone |
| InChIKey | SJYXUPGLQCUYJS-UHFFFAOYSA-N |
| SMILES | CC1(OCC2=C(O1)C=CC(=C2)C(=O)CBr)C |
Computed by PubChem (NCBI)