cas: 67822-75-7 — see every product listed under this CAS number, including other names
2-Benzyl-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 95% (CAS 67822-75-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FH5G-1g |
| cas | 67822-75-7 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 25g | 549.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-benzyl-1,3-dioxoisoindole-5-carboxylic acid (CAS 67822-75-7) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 2-benzyl-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: KGHOAEZOEVGKMU-UHFFFAOYSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 2-benzyl-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | KGHOAEZOEVGKMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)