CAS 227598-41-6 appears in our catalog under these names: 4-(1,3-Dioxo-1,3-dihydro-isoindol-2-ylmethyl)-benzoic acid, 98%, Benzoic acid, 4-((1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl)-. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g, 25g.
4-[(1,3-dioxoisoindol-2-yl)methyl]benzoic acid (CAS 227598-41-6) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoic acid. InChIKey: NIHMCLGGARGAHJ-UHFFFAOYSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoic acid |
| InChIKey | NIHMCLGGARGAHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)