cas: 67822-75-7 — see every product listed under this CAS number, including other names
2-benzyl-1,3-dioxoisoindoline-5-carboxylic acid, 95% (CAS 67822-75-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F346785-250MG |
| cas | 67822-75-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 10g | 383.22 Pln | |
| Fluorochem | 25g | 716.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-benzyl-1,3-dioxoisoindole-5-carboxylic acid (CAS 67822-75-7) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 2-benzyl-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: KGHOAEZOEVGKMU-UHFFFAOYSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 2-benzyl-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | KGHOAEZOEVGKMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)