Products 420101-13-9

CAS 420101-13-9 is the registry number for 3-(1,3-Dioxo-1,3-dihydro-2h-isoindol-2-yl)-4-methylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoic acid (CAS 420101-13-9) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoic acid. InChIKey: ANMZERJXLKKHDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H11NO4
Molecular weight281.26 g/mol
IUPAC name3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoic acid
InChIKeyANMZERJXLKKHDQ-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C(=O)O)N2C(=O)C3=CC=CC=C3C2=O

Computed by PubChem (NCBI)