CAS 420101-13-9 is the registry number for 3-(1,3-Dioxo-1,3-dihydro-2h-isoindol-2-yl)-4-methylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoic acid (CAS 420101-13-9) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoic acid. InChIKey: ANMZERJXLKKHDQ-UHFFFAOYSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoic acid |
| InChIKey | ANMZERJXLKKHDQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)