CAS 13475-43-9 is the registry number for [4-(1,3-Dioxoisoindol-2-yl)phenyl]acetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-[4-(1,3-dioxoisoindol-2-yl)phenyl]acetic acid (CAS 13475-43-9) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]acetic acid. InChIKey: FOHDBGDUZGVZBC-UHFFFAOYSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]acetic acid |
| InChIKey | FOHDBGDUZGVZBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=C(C=C3)CC(=O)O |
Computed by PubChem (NCBI)