CAS 67822-75-7 appears in our catalog under these names: 2-Benzyl-1,3-dioxoisoindoline-5-carboxylic acid, 97%, 2-Benzyl-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 95%, 2-benzyl-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 1g, 5g, 250mg.
2-benzyl-1,3-dioxoisoindole-5-carboxylic acid (CAS 67822-75-7) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 2-benzyl-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: KGHOAEZOEVGKMU-UHFFFAOYSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 2-benzyl-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | KGHOAEZOEVGKMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)