CAS 57278-51-0 appears in our catalog under these names: 4-Oxo-6-phenoxy-1,4-dihydroquinoline-3-carboxylic acid, 95%, 4-Oxo-6-phenoxy-1,4-dihydroquinoline-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
4-oxo-6-phenoxy-1H-quinoline-3-carboxylic acid (CAS 57278-51-0) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 4-oxo-6-phenoxy-1H-quinoline-3-carboxylic acid. InChIKey: NTPGNGGZYMRORF-UHFFFAOYSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 4-oxo-6-phenoxy-1H-quinoline-3-carboxylic acid |
| InChIKey | NTPGNGGZYMRORF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC3=C(C=C2)NC=C(C3=O)C(=O)O |
Computed by PubChem (NCBI)