CAS 67822-73-5 is the registry number for 2-(3-Methylphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
2-(3-methylphenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 67822-73-5) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 2-(3-methylphenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: WHMUJAYJCCNHQI-UHFFFAOYSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 2-(3-methylphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | WHMUJAYJCCNHQI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)