cas: 151427-19-9 — see every product listed under this CAS number, including other names
2-Bromo-1-(2,3-dihydrobenzofuran-5-yl)ethanone, 95%, 95% (CAS 151427-19-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112NC1-100mg |
| cas | 151427-19-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 746.00 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 1994.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-(2,3-dihydro-1-benzofuran-5-yl)ethanone (CAS 151427-19-9) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 2-bromo-1-(2,3-dihydro-1-benzofuran-5-yl)ethanone. InChIKey: CZRHIPGIDWESKD-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 2-bromo-1-(2,3-dihydro-1-benzofuran-5-yl)ethanone |
| InChIKey | CZRHIPGIDWESKD-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C(=O)CBr |
Computed by PubChem (NCBI)