CAS 892152-26-0 appears in our catalog under these names: 7-Bromo-6-methoxy-2,3-dihydro-1h-inden-1-one, 95%, 7-Bromo-6-methoxy-2,3-dihydro-1H-inden-1-one, 97%, 7-Bromo-6-methoxy-2,3-dihydro-1H-inden-1-one, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g.
7-bromo-6-methoxy-2,3-dihydroinden-1-one (CAS 892152-26-0) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 7-bromo-6-methoxy-2,3-dihydroinden-1-one. InChIKey: VRVDFHCIYLDELF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 7-bromo-6-methoxy-2,3-dihydroinden-1-one |
| InChIKey | VRVDFHCIYLDELF-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(CCC2=O)C=C1)Br |
Computed by PubChem (NCBI)