Products 97901-15-0
CAS 97901-15-0 appears in our catalog under these names: 5-Bromo-2,3-dihydro-1H-indene-2-carboxylic acid, 98%, 5-Bromoindan-2-carboxylic Acid, 5-Bromo-2,3-dihydro-1H-indene-2-carboxylic acid 96%, 5-Bromo-2,3-dihydro-1H-indene-2-carboxylic acid, 96%, 96%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg, 0,5g, 10g.
5-bromo-2,3-dihydro-1H-indene-2-carboxylic acid (CAS 97901-15-0) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1H-indene-2-carboxylic acid. InChIKey: OMJPTHPPEYUYLP-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1H-indene-2-carboxylic acid |
| InChIKey | OMJPTHPPEYUYLP-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)