CAS 175168-70-4 appears in our catalog under these names: rac-(1r,2r)-2-(2-bromophenyl)cyclopropane-1-carboxylic acid, 95%, rel-(1R,2R)-2-(2-Bromophenyl)cyclopropane-1-carboxylic acid, rel-(1S,2S)-2-(2-Bromophenyl)cyclopropane-1-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 10g.
Trans-(1R,2R)-2-(2-bromophenyl)cyclopropane-1-carboxylic acid (CAS 175168-70-4) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: trans-(1R,2R)-2-(2-bromophenyl)cyclopropane-1-carboxylic acid. InChIKey: SJXGNJABBYVEHY-JGVFFNPUSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | trans-(1R,2R)-2-(2-bromophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | SJXGNJABBYVEHY-JGVFFNPUSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)