CAS 1337838-55-7 appears in our catalog under these names: 6-Bromo-5-methylchroman-4-one, 95%, 6–Bromo–5–methylchroman–4–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
6-bromo-5-methyl-2,3-dihydrochromen-4-one (CAS 1337838-55-7) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 6-bromo-5-methyl-2,3-dihydrochromen-4-one. InChIKey: UASHKMPDERMSOM-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 6-bromo-5-methyl-2,3-dihydrochromen-4-one |
| InChIKey | UASHKMPDERMSOM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C(=O)CCO2)Br |
Computed by PubChem (NCBI)