CAS 55580-08-0 appears in our catalog under these names: 7-Bromo-3,4-dihydro-2h-benzo[b]oxepin-5-one, 95%, 7–Bromo–3,4–dihydrobenzo(b)oxepin–5(2H)–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg.
7-bromo-3,4-dihydro-2H-1-benzoxepin-5-one (CAS 55580-08-0) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 7-bromo-3,4-dihydro-2H-1-benzoxepin-5-one. InChIKey: JMIWCASGALGDMJ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-2H-1-benzoxepin-5-one |
| InChIKey | JMIWCASGALGDMJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C2)Br)OC1 |
Computed by PubChem (NCBI)