CAS 1131622-50-8 appears in our catalog under these names: 3-Bromo-4-cyclopropylbenzoic acid, 95%, 3-Bromo-4-cyclopropylbenzoic acid 98%, 3-Bromo-4-cyclopropylbenzoic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-bromo-4-cyclopropylbenzoic acid (CAS 1131622-50-8) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 3-bromo-4-cyclopropylbenzoic acid. InChIKey: YGSSCOWWLLABAH-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 3-bromo-4-cyclopropylbenzoic acid |
| InChIKey | YGSSCOWWLLABAH-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C=C(C=C2)C(=O)O)Br |
Computed by PubChem (NCBI)