Products 1262018-17-6
CAS 1262018-17-6 appears in our catalog under these names: 3-Bromo-5-methylcinnamic acid, 95%, 3-(3-Bromo-5-methylphenyl)acrylic acid, 98%, 3-(3-bromo-5-methylphenyl)prop-2-enoic acid, ≥95%, ≥95%, (E)-3-(3-Bromo-5-methylphenyl)acrylic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(E)-3-(3-bromo-5-methylphenyl)prop-2-enoic acid (CAS 1262018-17-6) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: (E)-3-(3-bromo-5-methylphenyl)prop-2-enoic acid. InChIKey: DSMGVINLXZECBW-NSCUHMNNSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | (E)-3-(3-bromo-5-methylphenyl)prop-2-enoic acid |
| InChIKey | DSMGVINLXZECBW-NSCUHMNNSA-N |
| SMILES | CC1=CC(=CC(=C1)Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(E)-3-(3-bromo-5-methylphenyl)acrylic acid, 3-(3-bromo-5-methylphenyl)prop-2-enoic acid, (2E)-3-(3-bromo-5-methylphenyl)prop-2-enoic acid, 3-Bromo-5-methylcinnamic acid, 3-(3-Bromo-5-methylphenyl)acrylic acid, 3-(3-Bromo-5-methylphenyl)-2-propenoic acid, (E)-3-(3-bromo-5-methylphenyl)prop-2-enoic acid