cas: 1621375-69-6 — see every product listed under this CAS number, including other names
2-Bromo-1-(3,4-difluoro-2-hydroxyphenyl)ethan-1-one 95% (CAS 1621375-69-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1045036-5g |
| cas | 1621375-69-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 7991.00 Pln | |
| Ambeed | 100mg | 509.44 Pln | |
| Ambeed | 250mg | 809.81 Pln | |
| Ambeed | 1g | 2050.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1045036 |
2-bromo-1-(3,4-difluoro-2-hydroxyphenyl)ethanone (CAS 1621375-69-6) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 2-bromo-1-(3,4-difluoro-2-hydroxyphenyl)ethanone. InChIKey: HCRCQCWWMQRSKQ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-bromo-1-(3,4-difluoro-2-hydroxyphenyl)ethanone |
| InChIKey | HCRCQCWWMQRSKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)CBr)O)F)F |
Computed by PubChem (NCBI)