Products 1805523-44-7
CAS 1805523-44-7 appears in our catalog under these names: Methyl 2-bromo-3,6-difluorobenzoate, 95%, Methyl 2–bromo–3，6–difluorobenzoate, Methyl 2-bromo-3,6-difluorobenzoate, Methyl 2-bromo-3,6-difluorobenzoate 97%, Benzoic acid, 2-bromo-3,6-difluoro-, methyl ester, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g, 10g, 25g.
Methyl 2-bromo-3,6-difluorobenzoate (CAS 1805523-44-7) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 2-bromo-3,6-difluorobenzoate. InChIKey: KIEJIRZTQOYEMQ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 2-bromo-3,6-difluorobenzoate |
| InChIKey | KIEJIRZTQOYEMQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1Br)F)F |
Computed by PubChem (NCBI)