CAS 1805523-36-7 appears in our catalog under these names: Methyl 2-bromo-3,4-difluorobenzoate, 98%, Methyl 2-bromo-3,4-difluorobenzoate 98%, Methyl 2-bromo-3,4-difluorobenzoate, 98%, 98%, METHYL 2-BROMO-3,4-DIFLUOROBENZOATE, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g.
Methyl 2-bromo-3,4-difluorobenzoate (CAS 1805523-36-7) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 2-bromo-3,4-difluorobenzoate. InChIKey: VZZHRHDBHLFPBY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 2-bromo-3,4-difluorobenzoate |
| InChIKey | VZZHRHDBHLFPBY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)F)F)Br |
Computed by PubChem (NCBI)