CAS 1375472-90-4 appears in our catalog under these names: (2-bromophenyl)difluoroacetic acid, 95%, 2-(2-Bromophenyl)-2,2-difluoroacetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 100mg, 5g, 250mg, 50mg, 0,5g.
2-(2-bromophenyl)-2,2-difluoroacetic acid (CAS 1375472-90-4) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(2-bromophenyl)-2,2-difluoroacetic acid. InChIKey: ALUGEFZIOIIHCE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(2-bromophenyl)-2,2-difluoroacetic acid |
| InChIKey | ALUGEFZIOIIHCE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)(F)F)Br |
Computed by PubChem (NCBI)