CAS 1780785-72-9 appears in our catalog under these names: 2-Bromo-3,4-difluorophenylacetic acid, 95%, 2-(2-Bromo-3,4-difluorophenyl)acetic acid, 2-(2-Bromo-3,4-difluorophenyl)acetic acid 97%, 2-(2-Bromo-3,4-difluorophenyl)acetic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-(2-bromo-3,4-difluorophenyl)acetic acid (CAS 1780785-72-9) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(2-bromo-3,4-difluorophenyl)acetic acid. InChIKey: NYGFDSVWTYZHQM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(2-bromo-3,4-difluorophenyl)acetic acid |
| InChIKey | NYGFDSVWTYZHQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC(=O)O)Br)F)F |
Computed by PubChem (NCBI)