Products 1807244-07-0
CAS 1807244-07-0 appears in our catalog under these names: methyl 4-bromo-2,3-difluorobenzoate, 98%, Methyl 4–bromo–2，3–difluorobenzoate, Methyl 4-bromo-2,3-difluorobenzoate, Methyl 4-bromo-2,3-difluorobenzoate 98%, Methyl 4-bromo-2,3-difluorobenzoate, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 25g, 100g, 500mg.
Methyl 4-bromo-2,3-difluorobenzoate (CAS 1807244-07-0) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 4-bromo-2,3-difluorobenzoate. InChIKey: QHVUOZGYQHNVAX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 4-bromo-2,3-difluorobenzoate |
| InChIKey | QHVUOZGYQHNVAX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Br)F)F |
Computed by PubChem (NCBI)