CAS 885068-76-8 appears in our catalog under these names: (3-bromophenyl)difluoroacetic acid, 95%, 2–(3–bromophenyl)–2,2–difluoroacetic acid, 2-(3-Bromophenyl)-2,2-difluoroacetic acid 98%, 2-(3-Bromophenyl)-2,2-difluoroacetic Acid, 98%, 98%, 2-(3-BROMOPHENYL)-2,2-DIFLUOROACETIC ACID, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
2-(3-bromophenyl)-2,2-difluoroacetic acid (CAS 885068-76-8) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(3-bromophenyl)-2,2-difluoroacetic acid. InChIKey: CYIBFFJUPHCMOO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(3-bromophenyl)-2,2-difluoroacetic acid |
| InChIKey | CYIBFFJUPHCMOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)