Products 1378875-92-3
CAS 1378875-92-3 appears in our catalog under these names: Methyl 3-bromo-2,6-difluorobenzoate, Methyl 3-bromo-2,6-difluorobenzoate, 95%, Methyl 3-bromo-2,6-difluorobenzoate 98%, METHYL 3-BROMO-2,6-DIFLUOROBENZOATE, 98%, Methyl 3-bromo-2,6-difluorobenzoate, 98%, 98%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g, 25g.
Methyl 3-bromo-2,6-difluorobenzoate (CAS 1378875-92-3) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 3-bromo-2,6-difluorobenzoate. InChIKey: FDVRSJQCIUFAKY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 3-bromo-2,6-difluorobenzoate |
| InChIKey | FDVRSJQCIUFAKY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)Br)F |
Computed by PubChem (NCBI)