cas: 220607-75-0 — see every product listed under this CAS number, including other names
2-Bromo-1-(3,5-difluorophenyl)ethanone 95% (CAS 220607-75-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A821261-1g |
| cas | 220607-75-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 687.44 Pln | |
| Ambeed | 25g | 2467.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A821261 |
2-bromo-1-(3,5-difluorophenyl)ethanone (CAS 220607-75-0) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 2-bromo-1-(3,5-difluorophenyl)ethanone. InChIKey: CJEGSZFRYLCTLK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 2-bromo-1-(3,5-difluorophenyl)ethanone |
| InChIKey | CJEGSZFRYLCTLK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(=O)CBr |
Computed by PubChem (NCBI)