cas: 18523-22-3 — see every product listed under this CAS number, including other names
2-Bromo-1-(3-bromophenyl)ethanone 98+% (CAS 18523-22-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1482514-1g |
| cas | 18523-22-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1193.62 Pln | |
| Ambeed | 500g | 4575.62 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1482514 |
2-bromo-1-(3-bromophenyl)ethanone (CAS 18523-22-3) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 2-bromo-1-(3-bromophenyl)ethanone. InChIKey: MZBXSQBQPJWECM-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 2-bromo-1-(3-bromophenyl)ethanone |
| InChIKey | MZBXSQBQPJWECM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)CBr |
Computed by PubChem (NCBI)