cas: 1099598-18-1 — see every product listed under this CAS number, including other names
2-Bromo-1-fluoro-4-(2,2,2-trifluoroethyl)benzene, 98% (CAS 1099598-18-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A464438-10g |
| cas | 1099598-18-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 15895.81 Pln | |
| AmBeed | 5g | 10394.86 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-bromo-1-fluoro-4-(2,2,2-trifluoroethyl)benzene (CAS 1099598-18-1) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 2-bromo-1-fluoro-4-(2,2,2-trifluoroethyl)benzene. InChIKey: RLLUHBAOHDDFML-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 2-bromo-1-fluoro-4-(2,2,2-trifluoroethyl)benzene |
| InChIKey | RLLUHBAOHDDFML-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(F)(F)F)Br)F |
Computed by PubChem (NCBI)