CAS 1186194-81-9 is the registry number for 2-Bromo-4-fluoro-1-(2,2,2-trifluoroethyl)-benzene. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
2-bromo-4-fluoro-1-(2,2,2-trifluoroethyl)benzene (CAS 1186194-81-9) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 2-bromo-4-fluoro-1-(2,2,2-trifluoroethyl)benzene. InChIKey: WRUCFQFVEHTUND-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 2-bromo-4-fluoro-1-(2,2,2-trifluoroethyl)benzene |
| InChIKey | WRUCFQFVEHTUND-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)CC(F)(F)F |
Computed by PubChem (NCBI)