cas: 573-54-6 — see every product listed under this CAS number, including other names
2-Bromo-3-nitrobenzoic Acid, >98.0%(T) (CAS 573-54-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B3322-5G |
| cas | 573-54-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 536.31 Pln | |
| TCI | 25g | 2006.57 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
2-bromo-3-nitrobenzoic acid (CAS 573-54-6) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 2-bromo-3-nitrobenzoic acid. InChIKey: WTDJEGSXLFHZPY-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 2-bromo-3-nitrobenzoic acid |
| InChIKey | WTDJEGSXLFHZPY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Br)C(=O)O |
Computed by PubChem (NCBI)