cas: 573-54-6 — see every product listed under this CAS number, including other names
2-Bromo-3-nitrobenzoic acid, 98%, 98% (CAS 573-54-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GN8-250mg |
| cas | 573-54-6 |
| size | 250mg |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 222.80 Pln | |
| Chemat | 100g | 693.20 Pln | |
| Chemat | 50g | 376.40 Pln | |
| Chemat | 250g | 1619.60 Pln | |
| Chemat | 500g | 3235.20 Pln | |
| Chemat | 1kg | 4605.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-3-nitrobenzoic acid (CAS 573-54-6) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 2-bromo-3-nitrobenzoic acid. InChIKey: WTDJEGSXLFHZPY-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 2-bromo-3-nitrobenzoic acid |
| InChIKey | WTDJEGSXLFHZPY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Br)C(=O)O |
Computed by PubChem (NCBI)