cas: 911799-84-3 — see every product listed under this CAS number, including other names
2-Bromo-4-(methoxycarbonyl)benzoic acid, 95%, 95% (CAS 911799-84-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FOUI-100mg |
| cas | 911799-84-3 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 923.60 Pln | |
| Chemat | 5g | 3078.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-4-methoxycarbonylbenzoic acid (CAS 911799-84-3) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 2-bromo-4-methoxycarbonylbenzoic acid. InChIKey: NVIVSQBLUICPCL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 2-bromo-4-methoxycarbonylbenzoic acid |
| InChIKey | NVIVSQBLUICPCL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)