cas: 1114808-87-5 — see every product listed under this CAS number, including other names
2-Bromo-4-(trifluoromethoxy)benzaldehyde 98% (CAS 1114808-87-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A362207-250mg |
| cas | 1114808-87-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1171.38 Pln | |
| Ambeed | 25g | 3368.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A362207 |
2-bromo-4-(trifluoromethoxy)benzaldehyde (CAS 1114808-87-5) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 2-bromo-4-(trifluoromethoxy)benzaldehyde. InChIKey: NTFBYDIXDWHKBX-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethoxy)benzaldehyde |
| InChIKey | NTFBYDIXDWHKBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Br)C=O |
Computed by PubChem (NCBI)