cas: 54151-74-5 — see every product listed under this CAS number, including other names
2-Bromo-4-phenylpyridine 97% (CAS 54151-74-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A185231-100mg |
| cas | 54151-74-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1149.12 Pln | |
| Ambeed | 100g | 4369.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A185231 |
2-bromo-4-phenylpyridine (CAS 54151-74-5) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 2-bromo-4-phenylpyridine. InChIKey: KRIILKQTJUOQCJ-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 2-bromo-4-phenylpyridine |
| InChIKey | KRIILKQTJUOQCJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC=C2)Br |
Computed by PubChem (NCBI)