2-Bromo-5,6-difluorophenylboronic acid, 98%, 98%
cas: 870718-10-8 — see every product listed under this CAS number, including other names
2-Bromo-5,6-difluorophenylboronic acid, 98%, 98% (CAS 870718-10-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BYM-100mg |
| cas | 870718-10-8 |
| size | 100mg |
| availability | 125g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 496.40 Pln | |
| Chemat | 10g | 789.20 Pln | |
| Chemat | 25g | 1442.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(6-bromo-2,3-difluorophenyl)boronic acid (CAS 870718-10-8) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (6-bromo-2,3-difluorophenyl)boronic acid. InChIKey: VZVDYVBOSRNBQL-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (6-bromo-2,3-difluorophenyl)boronic acid |
| InChIKey | VZVDYVBOSRNBQL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)F)Br)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(6-bromo-2,3-difluorophenyl)boronic acid, 6-Bromo-2,3-difluorophenylboronic acid, 2-Bromo-5,6-difluorophenylboronic acid, (6-Bromo-2,3-difluoro-phenyl)boronic acid, (6-Bromo-2,3-difluorophenyl)boronicacid, (6-bromo-2,3-difluorophenyl)-, 6-Bromo-2,3-difluorophenylboronic acid(contains varying amounts of anhydride)