(6-Bromo-2,3-difluorophenyl)boronic acid, 98%
cas: 870718-10-8 — see every product listed under this CAS number, including other names
(6-Bromo-2,3-difluorophenyl)boronic acid, 98% (CAS 870718-10-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A270235-1g |
| cas | 870718-10-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 323.89 Pln | |
| Fluorochem | 1g | 325.94 Pln | |
| Fluorochem | 5g | 476.93 Pln | |
| Fluorochem | 10g | 763.29 Pln | |
| Fluorochem | 25g | 1450.55 Pln | |
| Fluorochem | 100g | 3392.57 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(6-bromo-2,3-difluorophenyl)boronic acid (CAS 870718-10-8) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (6-bromo-2,3-difluorophenyl)boronic acid. InChIKey: VZVDYVBOSRNBQL-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (6-bromo-2,3-difluorophenyl)boronic acid |
| InChIKey | VZVDYVBOSRNBQL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)F)Br)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(6-bromo-2,3-difluorophenyl)boronic acid, 6-Bromo-2,3-difluorophenylboronic acid, 2-Bromo-5,6-difluorophenylboronic acid, (6-Bromo-2,3-difluoro-phenyl)boronic acid, (6-Bromo-2,3-difluorophenyl)boronicacid, (6-bromo-2,3-difluorophenyl)-, 6-Bromo-2,3-difluorophenylboronic acid(contains varying amounts of anhydride)