cas: 367-67-9 — see every product listed under this CAS number, including other names
2-Bromo-5-nitrobenzotrifluoride, 98%, 98% (CAS 367-67-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I80L-10g |
| cas | 367-67-9 |
| size | 10g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 50g | 141.20 Pln | |
| Chemat | 100g | 218.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-nitro-2-(trifluoromethyl)benzene (CAS 367-67-9) is a chemical compound with the molecular formula C7H3BrF3NO2 and a molecular weight of 270.00 g/mol. IUPAC name: 1-bromo-4-nitro-2-(trifluoromethyl)benzene. InChIKey: SXEQQBBOAMHOID-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO2 |
|---|---|
| Molecular weight | 270.00 g/mol |
| IUPAC name | 1-bromo-4-nitro-2-(trifluoromethyl)benzene |
| InChIKey | SXEQQBBOAMHOID-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)Br |
Computed by PubChem (NCBI)