CAS 2792186-74-2 is the registry number for 2-(6-Bromo-5-fluoropyridin-2-yl)-2,2-difluoroacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6-bromo-5-fluoro-2-pyridinyl)-2,2-difluoroacetic acid (CAS 2792186-74-2) is a chemical compound with the molecular formula C7H3BrF3NO2 and a molecular weight of 270.00 g/mol. IUPAC name: 2-(6-bromo-5-fluoro-2-pyridinyl)-2,2-difluoroacetic acid. InChIKey: LACBAFFIVMLJLZ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO2 |
|---|---|
| Molecular weight | 270.00 g/mol |
| IUPAC name | 2-(6-bromo-5-fluoro-2-pyridinyl)-2,2-difluoroacetic acid |
| InChIKey | LACBAFFIVMLJLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1F)Br)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)