Products 1211580-84-5
CAS 1211580-84-5 appears in our catalog under these names: 5-Bromo-3-(trifluoromethyl)picolinic acid, 95%, 5-Bromo-3-(trifluoromethyl)-2-pyridinecarboxylic acid 98%, 5-Bromo-3-(trifluoromethyl)-2-pyridinecarboxylic acid, 97%, 97%, 5-Bromo-3-(trifluoromethyl)-2-pyridinecarboxylic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 15g, 25g.
5-bromo-3-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 1211580-84-5) is a chemical compound with the molecular formula C7H3BrF3NO2 and a molecular weight of 270.00 g/mol. IUPAC name: 5-bromo-3-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: PQVPMPDGEIKZRG-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO2 |
|---|---|
| Molecular weight | 270.00 g/mol |
| IUPAC name | 5-bromo-3-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | PQVPMPDGEIKZRG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)C(=O)O)Br |
Computed by PubChem (NCBI)